C8H9F3N2O3 — CID 118848207
6-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 118848207) has the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. Its IUPAC name is 6-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 6-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118848207 |
| Molecular Formula | C8H9F3N2O3 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 6-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | COc1c(OC(F)(F)F)cc(=O)[nH]c1CN |
| InChI | InChI=1S/C8H9F3N2O3/c1-15-7-4(3-12)13-6(14)2-5(7)16-8(9,10)11/h2H,3,12H2,1H3,(H,13,14) |
| InChIKey | RUAOOHSCPSCFFI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |