C7H5ClF3NO5S — CID 131311062
2-methoxy-6-oxo-4-(trifluoromethoxy)-1H-pyridine-3-sulfonyl chloride (PubChem CID 131311062) has the molecular formula C7H5ClF3NO5S and a molecular weight of 307.63 g/mol. Its IUPAC name is 2-methoxy-6-oxo-4-(trifluoromethoxy)-1H-pyridine-3-sulfonyl chloride.
| Compound Name | 2-methoxy-6-oxo-4-(trifluoromethoxy)-1H-pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 131311062 |
| Molecular Formula | C7H5ClF3NO5S |
| Molecular Weight | 307.63 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 2-methoxy-6-oxo-4-(trifluoromethoxy)-1H-pyridine-3-sulfonyl chloride |
| SMILES | COc1[nH]c(=O)cc(OC(F)(F)F)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H5ClF3NO5S/c1-16-6-5(18(8,14)15)3(2-4(13)12-6)17-7(9,10)11/h2H,1H3,(H,12,13) |
| InChIKey | STZCLCKGLGJRBV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |