C7H5ClF3NO4S — CID 131305685
5-methyl-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride (PubChem CID 131305685) has the molecular formula C7H5ClF3NO4S and a molecular weight of 291.63 g/mol. Its IUPAC name is 5-methyl-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride.
| Compound Name | 5-methyl-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride |
|---|---|
| PubChem CID | 131305685 |
| Molecular Formula | C7H5ClF3NO4S |
| Molecular Weight | 291.63 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 5-methyl-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride |
| SMILES | Cc1c[nH]c(=O)c(OC(F)(F)F)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H5ClF3NO4S/c1-3-2-12-6(13)4(16-7(9,10)11)5(3)17(8,14)15/h2H,1H3,(H,12,13) |
| InChIKey | LTNJIODOIIPFQJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.63 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |