C10H10F3NO4 — CID 134665731
ethyl 5-methyl-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carboxylate (PubChem CID 134665731) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is ethyl 5-methyl-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carboxylate.
| Compound Name | ethyl 5-methyl-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134665731 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | ethyl 5-methyl-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)c[nH]c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO4/c1-3-17-9(16)6-5(2)4-14-8(15)7(6)18-10(11,12)13/h4H,3H2,1-2H3,(H,14,15) |
| InChIKey | DDRRISOZVQXWFP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |