C8H5BrF3NO4 — CID 134666729
5-(bromomethyl)-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carboxylic acid (PubChem CID 134666729) has the molecular formula C8H5BrF3NO4 and a molecular weight of 316.03 g/mol. Its IUPAC name is 5-(bromomethyl)-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carboxylic acid.
| Compound Name | 5-(bromomethyl)-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 134666729 |
| Molecular Formula | C8H5BrF3NO4 |
| Molecular Weight | 316.03 g/mol |
| Exact Mass | 314.94 |
| IUPAC Name | 5-(bromomethyl)-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1c(CBr)c[nH]c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C8H5BrF3NO4/c9-1-3-2-13-6(14)5(4(3)7(15)16)17-8(10,11)12/h2H,1H2,(H,13,14)(H,15,16) |
| InChIKey | KQCNZDGAUVJEGV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.03 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|