C8H4BrF6NO2 — CID 134680867
4-(bromomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 134680867) has the molecular formula C8H4BrF6NO2 and a molecular weight of 340.02 g/mol. Its IUPAC name is 4-(bromomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 4-(bromomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134680867 |
| Molecular Formula | C8H4BrF6NO2 |
| Molecular Weight | 340.02 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | 4-(bromomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C(F)(F)F)c(CBr)c1OC(F)(F)F |
| InChI | InChI=1S/C8H4BrF6NO2/c9-1-3-4(7(10,11)12)2-16-6(17)5(3)18-8(13,14)15/h2H,1H2,(H,16,17) |
| InChIKey | MTVBBSVAXKLEKC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.02 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|