C8H7BrF3NO2 — CID 130111899
3-(bromomethyl)-4-methyl-5-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 130111899) has the molecular formula C8H7BrF3NO2 and a molecular weight of 286.05 g/mol. Its IUPAC name is 3-(bromomethyl)-4-methyl-5-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 3-(bromomethyl)-4-methyl-5-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130111899 |
| Molecular Formula | C8H7BrF3NO2 |
| Molecular Weight | 286.05 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 3-(bromomethyl)-4-methyl-5-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | Cc1c(OC(F)(F)F)c[nH]c(=O)c1CBr |
| InChI | InChI=1S/C8H7BrF3NO2/c1-4-5(2-9)7(14)13-3-6(4)15-8(10,11)12/h3H,2H2,1H3,(H,13,14) |
| InChIKey | ILQFUAPMPWNQEJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.05 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|