C7H4ClF3N2O4 — CID 134676871
4-(chloromethyl)-5-nitro-3-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 134676871) has the molecular formula C7H4ClF3N2O4 and a molecular weight of 272.57 g/mol. Its IUPAC name is 4-(chloromethyl)-5-nitro-3-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 4-(chloromethyl)-5-nitro-3-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134676871 |
| Molecular Formula | C7H4ClF3N2O4 |
| Molecular Weight | 272.57 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 4-(chloromethyl)-5-nitro-3-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc([N+](=O)[O-])c(CCl)c1OC(F)(F)F |
| InChI | InChI=1S/C7H4ClF3N2O4/c8-1-3-4(13(15)16)2-12-6(14)5(3)17-7(9,10)11/h2H,1H2,(H,12,14) |
| InChIKey | CMCKKXJJJQOHDP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|