C7H5F3N2O5 — CID 134666490
3-(hydroxymethyl)-5-nitro-4-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 134666490) has the molecular formula C7H5F3N2O5 and a molecular weight of 254.12 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-nitro-4-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 3-(hydroxymethyl)-5-nitro-4-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134666490 |
| Molecular Formula | C7H5F3N2O5 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 3-(hydroxymethyl)-5-nitro-4-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc([N+](=O)[O-])c(OC(F)(F)F)c1CO |
| InChI | InChI=1S/C7H5F3N2O5/c8-7(9,10)17-5-3(2-13)6(14)11-1-4(5)12(15)16/h1,13H,2H2,(H,11,14) |
| InChIKey | OJXUFMIFJSZEFN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|