C8H7F4NO3 — CID 134679059
5-(fluoromethyl)-2-(hydroxymethyl)-3-(trifluoromethoxy)-1H-pyridin-4-one (PubChem CID 134679059) has the molecular formula C8H7F4NO3 and a molecular weight of 241.14 g/mol. Its IUPAC name is 5-(fluoromethyl)-2-(hydroxymethyl)-3-(trifluoromethoxy)-1H-pyridin-4-one.
| Compound Name | 5-(fluoromethyl)-2-(hydroxymethyl)-3-(trifluoromethoxy)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 134679059 |
| Molecular Formula | C8H7F4NO3 |
| Molecular Weight | 241.14 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5-(fluoromethyl)-2-(hydroxymethyl)-3-(trifluoromethoxy)-1H-pyridin-4-one |
| SMILES | O=c1c(CF)c[nH]c(CO)c1OC(F)(F)F |
| InChI | InChI=1S/C8H7F4NO3/c9-1-4-2-13-5(3-14)7(6(4)15)16-8(10,11)12/h2,14H,1,3H2,(H,13,15) |
| InChIKey | RERLYIRCILVWIG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.14 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |