C8H7F3N2O4 — CID 118808776
6-(aminomethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carboxylic acid (PubChem CID 118808776) has the molecular formula C8H7F3N2O4 and a molecular weight of 252.15 g/mol. Its IUPAC name is 6-(aminomethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-(aminomethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118808776 |
| Molecular Formula | C8H7F3N2O4 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 6-(aminomethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carboxylic acid |
| SMILES | NCc1[nH]cc(C(=O)O)c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O4/c9-8(10,11)17-6-4(1-12)13-2-3(5(6)14)7(15)16/h2H,1,12H2,(H,13,14)(H,15,16) |
| InChIKey | QQPJFPXCLIULTF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |