C8H5ClF3NO4 — CID 134666645
6-methoxy-4-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carbonyl chloride (PubChem CID 134666645) has the molecular formula C8H5ClF3NO4 and a molecular weight of 271.58 g/mol. Its IUPAC name is 6-methoxy-4-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carbonyl chloride.
| Compound Name | 6-methoxy-4-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 134666645 |
| Molecular Formula | C8H5ClF3NO4 |
| Molecular Weight | 271.58 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 6-methoxy-4-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carbonyl chloride |
| SMILES | COc1[nH]cc(C(=O)Cl)c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C8H5ClF3NO4/c1-16-7-5(17-8(10,11)12)4(14)3(2-13-7)6(9)15/h2H,1H3,(H,13,14) |
| InChIKey | VAVUJTIXKRIPTH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.58 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|