C9H8F3NO5 — CID 134665312
2-[4-methoxy-6-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetic acid (PubChem CID 134665312) has the molecular formula C9H8F3NO5 and a molecular weight of 267.16 g/mol. Its IUPAC name is 2-[4-methoxy-6-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetic acid.
| Compound Name | 2-[4-methoxy-6-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 134665312 |
| Molecular Formula | C9H8F3NO5 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-[4-methoxy-6-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetic acid |
| SMILES | COc1c(CC(=O)O)c[nH]c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C9H8F3NO5/c1-17-6-4(2-5(14)15)3-13-8(16)7(6)18-9(10,11)12/h3H,2H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | VOZBLICNUONAGY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |