C9H7ClF3NO3 — CID 123666012
3-methoxy-2-oxo-5-(2,2,2-trifluoroethyl)-1H-pyridine-4-carbonyl chloride (PubChem CID 123666012) has the molecular formula C9H7ClF3NO3 and a molecular weight of 269.61 g/mol. Its IUPAC name is 3-methoxy-2-oxo-5-(2,2,2-trifluoroethyl)-1H-pyridine-4-carbonyl chloride.
| Compound Name | 3-methoxy-2-oxo-5-(2,2,2-trifluoroethyl)-1H-pyridine-4-carbonyl chloride |
|---|---|
| PubChem CID | 123666012 |
| Molecular Formula | C9H7ClF3NO3 |
| Molecular Weight | 269.61 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 3-methoxy-2-oxo-5-(2,2,2-trifluoroethyl)-1H-pyridine-4-carbonyl chloride |
| SMILES | COc1c(C(=O)Cl)c(CC(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C9H7ClF3NO3/c1-17-6-5(7(10)15)4(2-9(11,12)13)3-14-8(6)16/h3H,2H2,1H3,(H,14,16) |
| InChIKey | FDIRVUDKWHVXLI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.61 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|