C9H7ClF3NO4 — CID 134660680
methyl 5-(chloromethyl)-4-oxo-2-(trifluoromethoxy)-1H-pyridine-3-carboxylate (PubChem CID 134660680) has the molecular formula C9H7ClF3NO4 and a molecular weight of 285.61 g/mol. Its IUPAC name is methyl 5-(chloromethyl)-4-oxo-2-(trifluoromethoxy)-1H-pyridine-3-carboxylate.
| Compound Name | methyl 5-(chloromethyl)-4-oxo-2-(trifluoromethoxy)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134660680 |
| Molecular Formula | C9H7ClF3NO4 |
| Molecular Weight | 285.61 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | methyl 5-(chloromethyl)-4-oxo-2-(trifluoromethoxy)-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(OC(F)(F)F)[nH]cc(CCl)c1=O |
| InChI | InChI=1S/C9H7ClF3NO4/c1-17-8(16)5-6(15)4(2-10)3-14-7(5)18-9(11,12)13/h3H,2H2,1H3,(H,14,15) |
| InChIKey | WDOWILJWMTYEFZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.61 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|