C10H9ClF3NO4 — CID 134668327
methyl 5-(chloromethyl)-2-methoxy-4-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134668327) has the molecular formula C10H9ClF3NO4 and a molecular weight of 299.63 g/mol. Its IUPAC name is methyl 5-(chloromethyl)-2-methoxy-4-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | methyl 5-(chloromethyl)-2-methoxy-4-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134668327 |
| Molecular Formula | C10H9ClF3NO4 |
| Molecular Weight | 299.63 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | methyl 5-(chloromethyl)-2-methoxy-4-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(OC)ncc(CCl)c1OC(F)(F)F |
| InChI | InChI=1S/C10H9ClF3NO4/c1-17-8-6(9(16)18-2)7(19-10(12,13)14)5(3-11)4-15-8/h4H,3H2,1-2H3 |
| InChIKey | VOBXGQRMVYSBEY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.63 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|