C9H6ClF4NO3 — CID 134659635
methyl 4-(chloromethyl)-5-fluoro-2-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134659635) has the molecular formula C9H6ClF4NO3 and a molecular weight of 287.60 g/mol. Its IUPAC name is methyl 4-(chloromethyl)-5-fluoro-2-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | methyl 4-(chloromethyl)-5-fluoro-2-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134659635 |
| Molecular Formula | C9H6ClF4NO3 |
| Molecular Weight | 287.60 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | methyl 4-(chloromethyl)-5-fluoro-2-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(OC(F)(F)F)ncc(F)c1CCl |
| InChI | InChI=1S/C9H6ClF4NO3/c1-17-8(16)6-4(2-10)5(11)3-15-7(6)18-9(12,13)14/h3H,2H2,1H3 |
| InChIKey | OHHWRZKAUDTXFT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|