C9H7Cl2F3O — CID 116932155
1,5-dichloro-2-methoxy-3-(2,2,2-trifluoroethyl)benzene (PubChem CID 116932155) has the molecular formula C9H7Cl2F3O and a molecular weight of 259.05 g/mol. Its IUPAC name is 1,5-dichloro-2-methoxy-3-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 1,5-dichloro-2-methoxy-3-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 116932155 |
| Molecular Formula | C9H7Cl2F3O |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 1,5-dichloro-2-methoxy-3-(2,2,2-trifluoroethyl)benzene |
| SMILES | COc1c(Cl)cc(Cl)cc1CC(F)(F)F |
| InChI | InChI=1S/C9H7Cl2F3O/c1-15-8-5(4-9(12,13)14)2-6(10)3-7(8)11/h2-3H,4H2,1H3 |
| InChIKey | BBDSEYKNGWPSIR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |