C10H15Cl2N3O — CID 115260966
1-(3,5-dichloro-2-methoxyphenyl)-N-(hydrazinylmethyl)-N-methylmethanamine (PubChem CID 115260966) has the molecular formula C10H15Cl2N3O and a molecular weight of 264.16 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-methoxyphenyl)-N-(hydrazinylmethyl)-N-methylmethanamine.
| Compound Name | 1-(3,5-dichloro-2-methoxyphenyl)-N-(hydrazinylmethyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115260966 |
| Molecular Formula | C10H15Cl2N3O |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-(3,5-dichloro-2-methoxyphenyl)-N-(hydrazinylmethyl)-N-methylmethanamine |
| SMILES | COc1c(Cl)cc(Cl)cc1CN(C)CNN |
| InChI | InChI=1S/C10H15Cl2N3O/c1-15(6-14-13)5-7-3-8(11)4-9(12)10(7)16-2/h3-4,14H,5-6,13H2,1-2H3 |
| InChIKey | MXEYEIBUXRZGMP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|