C11H12Cl2N2O — CID 117043509
2-(3,5-dichloro-2-methoxyphenyl)ethyl-methylcyanamide (PubChem CID 117043509) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-methoxyphenyl)ethyl-methylcyanamide.
| Compound Name | 2-(3,5-dichloro-2-methoxyphenyl)ethyl-methylcyanamide |
|---|---|
| PubChem CID | 117043509 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-(3,5-dichloro-2-methoxyphenyl)ethyl-methylcyanamide |
| SMILES | COc1c(Cl)cc(Cl)cc1CCN(C)C#N |
| InChI | InChI=1S/C11H12Cl2N2O/c1-15(7-14)4-3-8-5-9(12)6-10(13)11(8)16-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | KMBVVHRSKWQVRC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|