C12H16N2O2 — CID 117043452
2-(2,5-dimethoxyphenyl)ethyl-methylcyanamide (PubChem CID 117043452) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)ethyl-methylcyanamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)ethyl-methylcyanamide |
|---|---|
| PubChem CID | 117043452 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)ethyl-methylcyanamide |
| SMILES | COc1ccc(OC)c(CCN(C)C#N)c1 |
| InChI | InChI=1S/C12H16N2O2/c1-14(9-13)7-6-10-8-11(15-2)4-5-12(10)16-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | SPEZKBHEOPRCBA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|