C17H31NO2 — CID 142573770
N-[2-(2,5-dimethoxyphenyl)ethyl]-N-ethylpropan-2-amine;ethane (PubChem CID 142573770) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyphenyl)ethyl]-N-ethylpropan-2-amine;ethane.
| Compound Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-N-ethylpropan-2-amine;ethane |
|---|---|
| PubChem CID | 142573770 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-N-ethylpropan-2-amine;ethane |
| SMILES | CC.CCN(CCc1cc(OC)ccc1OC)C(C)C |
| InChI | InChI=1S/C15H25NO2.C2H6/c1-6-16(12(2)3)10-9-13-11-14(17-4)7-8-15(13)18-5;1-2/h7-8,11-12H,6,9-10H2,1-5H3;1-2H3 |
| InChIKey | KIXFXBNUJZWXGO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |