C12H17NO3S — CID 115170385
2-(2,5-dimethoxyphenyl)ethyl-methylcarbamothioic S-acid (PubChem CID 115170385) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)ethyl-methylcarbamothioic S-acid.
| Compound Name | 2-(2,5-dimethoxyphenyl)ethyl-methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 115170385 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)ethyl-methylcarbamothioic S-acid |
| SMILES | COc1ccc(OC)c(CCN(C)C(=O)S)c1 |
| InChI | InChI=1S/C12H17NO3S/c1-13(12(14)17)7-6-9-8-10(15-2)4-5-11(9)16-3/h4-5,8H,6-7H2,1-3H3,(H,14,17) |
| InChIKey | RRHUHSRQLYYPPH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|