(2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid

C11H15NO3S — CID 115170104

IUPAC(2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid
SMILESCOc1ccc(CN(C)C(=O)S)c(OC)c1
InChIInChI=1S/C11H15NO3S/c1-12(11(13)16)7-8-4-5-9(14-2)6-10(8)15-3/h4-6H,7H2,1-3H3,(H,13,16)
InChIKeyKXTVYCOXBXHXNF-UHFFFAOYSA-N
MW241.31 g/mol
LogP2.19
Rot. Bonds4

About (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid

(2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid (PubChem CID 115170104) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid.

Molecular Properties

Compound Name(2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid
PubChem CID115170104
Molecular FormulaC11H15NO3S
Molecular Weight241.31 g/mol
Exact Mass241.08
IUPAC Name(2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid
SMILESCOc1ccc(CN(C)C(=O)S)c(OC)c1
InChIInChI=1S/C11H15NO3S/c1-12(11(13)16)7-8-4-5-9(14-2)6-10(8)15-3/h4-6H,7H2,1-3H3,(H,13,16)
InChIKeyKXTVYCOXBXHXNF-UHFFFAOYSA-N
XLogP2.19
TPSA38.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.31
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid?
The IUPAC name of (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid (CID 115170104) is (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid.
What is the SMILES notation for (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid?
The canonical SMILES for (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid is COc1ccc(CN(C)C(=O)S)c(OC)c1.
What is the InChIKey of (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid?
The InChIKey is KXTVYCOXBXHXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S/c1-12(11(13)16)7-8-4-5-9(14-2)6-10(8)15-3/h4-6H,7H2,1-3H3,(H,13,16).
What are the key properties of (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid?
(2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid has a molecular weight of 241.31 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethoxyphenyl)methyl-methylcarbamothioic S-acid is sourced from PubChem (CID 115170104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).