2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid

C12H17NO4 — CID 60712632

IUPAC2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid
SMILESCOc1ccc(CN(C)CC(=O)O)c(OC)c1
InChIInChI=1S/C12H17NO4/c1-13(8-12(14)15)7-9-4-5-10(16-2)6-11(9)17-3/h4-6H,7-8H2,1-3H3,(H,14,15)
InChIKeyHXXXPQJSBKHBFR-UHFFFAOYSA-N
MW239.27 g/mol
LogP1.22
Rot. Bonds6

About 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid

2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid (PubChem CID 60712632) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid.

Molecular Properties

Compound Name2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid
PubChem CID60712632
Molecular FormulaC12H17NO4
Molecular Weight239.27 g/mol
Exact Mass239.12
IUPAC Name2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid
SMILESCOc1ccc(CN(C)CC(=O)O)c(OC)c1
InChIInChI=1S/C12H17NO4/c1-13(8-12(14)15)7-9-4-5-10(16-2)6-11(9)17-3/h4-6H,7-8H2,1-3H3,(H,14,15)
InChIKeyHXXXPQJSBKHBFR-UHFFFAOYSA-N
XLogP1.22
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.27
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid?
The IUPAC name of 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid (CID 60712632) is 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid.
What is the SMILES notation for 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid?
The canonical SMILES for 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid is COc1ccc(CN(C)CC(=O)O)c(OC)c1.
What is the InChIKey of 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid?
The InChIKey is HXXXPQJSBKHBFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-13(8-12(14)15)7-9-4-5-10(16-2)6-11(9)17-3/h4-6H,7-8H2,1-3H3,(H,14,15).
What are the key properties of 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid?
2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid has a molecular weight of 239.27 g/mol, XLogP of 1.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dimethoxyphenyl)methyl-methylamino]acetic acid is sourced from PubChem (CID 60712632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).