C15H23NO4 — CID 79268622
2-[tert-butyl-[(2,4-dimethoxyphenyl)methyl]amino]acetic acid (PubChem CID 79268622) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-[tert-butyl-[(2,4-dimethoxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[tert-butyl-[(2,4-dimethoxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 79268622 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[tert-butyl-[(2,4-dimethoxyphenyl)methyl]amino]acetic acid |
| SMILES | COc1ccc(CN(CC(=O)O)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)16(10-14(17)18)9-11-6-7-12(19-4)8-13(11)20-5/h6-8H,9-10H2,1-5H3,(H,17,18) |
| InChIKey | ZGDPTYHYNJSGKW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |