C15H19NO5 — CID 60827055
2-[cyclopropyl-[2-(2,4-dimethoxyphenyl)acetyl]amino]acetic acid (PubChem CID 60827055) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-(2,4-dimethoxyphenyl)acetyl]amino]acetic acid.
| Compound Name | 2-[cyclopropyl-[2-(2,4-dimethoxyphenyl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 60827055 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[cyclopropyl-[2-(2,4-dimethoxyphenyl)acetyl]amino]acetic acid |
| SMILES | COc1ccc(CC(=O)N(CC(=O)O)C2CC2)c(OC)c1 |
| InChI | InChI=1S/C15H19NO5/c1-20-12-6-3-10(13(8-12)21-2)7-14(17)16(9-15(18)19)11-4-5-11/h3,6,8,11H,4-5,7,9H2,1-2H3,(H,18,19) |
| InChIKey | YDLLMIRHQWIIJL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |