C19H23NO5 — CID 18111734
N-[(2,4-dimethoxyphenyl)methyl]-2,4-dimethoxy-N-methylbenzamide (PubChem CID 18111734) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-2,4-dimethoxy-N-methylbenzamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-2,4-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 18111734 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-2,4-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C19H23NO5/c1-20(12-13-6-7-14(22-2)10-17(13)24-4)19(21)16-9-8-15(23-3)11-18(16)25-5/h6-11H,12H2,1-5H3 |
| InChIKey | QTDBVXKPUGEYEG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |