C21H21NO3 — CID 18115021
2,4-dimethoxy-N-methyl-N-(naphthalen-2-ylmethyl)benzamide (PubChem CID 18115021) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2,4-dimethoxy-N-methyl-N-(naphthalen-2-ylmethyl)benzamide.
| Compound Name | 2,4-dimethoxy-N-methyl-N-(naphthalen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18115021 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2,4-dimethoxy-N-methyl-N-(naphthalen-2-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(C)Cc2ccc3ccccc3c2)c(OC)c1 |
| InChI | InChI=1S/C21H21NO3/c1-22(14-15-8-9-16-6-4-5-7-17(16)12-15)21(23)19-11-10-18(24-2)13-20(19)25-3/h4-13H,14H2,1-3H3 |
| InChIKey | CNWRKBMYXICADJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |