C15H17NO3 — CID 115140024
2-hydroxy-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylacetamide (PubChem CID 115140024) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-hydroxy-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylacetamide.
| Compound Name | 2-hydroxy-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 115140024 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-hydroxy-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylacetamide |
| SMILES | COc1ccc2cc(CN(C)C(=O)CO)ccc2c1 |
| InChI | InChI=1S/C15H17NO3/c1-16(15(18)10-17)9-11-3-4-13-8-14(19-2)6-5-12(13)7-11/h3-8,17H,9-10H2,1-2H3 |
| InChIKey | YOLSJZKQRMGYLM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |