C22H22ClNO3 — CID 8529237
2-(5-chloro-2-methoxyphenyl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylacetamide (PubChem CID 8529237) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylacetamide.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 8529237 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylacetamide |
| SMILES | COc1ccc2cc(CN(C)C(=O)Cc3cc(Cl)ccc3OC)ccc2c1 |
| InChI | InChI=1S/C22H22ClNO3/c1-24(22(25)13-18-11-19(23)7-9-21(18)27-3)14-15-4-5-17-12-20(26-2)8-6-16(17)10-15/h4-12H,13-14H2,1-3H3 |
| InChIKey | LBKOZLQUXXXPEG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |