C23H22ClNO3 — CID 9183650
N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-4-naphthalen-2-yl-4-oxobutanamide (PubChem CID 9183650) has the molecular formula C23H22ClNO3 and a molecular weight of 395.89 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-4-naphthalen-2-yl-4-oxobutanamide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-4-naphthalen-2-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 9183650 |
| Molecular Formula | C23H22ClNO3 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-4-naphthalen-2-yl-4-oxobutanamide |
| SMILES | COc1ccc(Cl)cc1CN(C)C(=O)CCC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H22ClNO3/c1-25(15-19-14-20(24)9-11-22(19)28-2)23(27)12-10-21(26)18-8-7-16-5-3-4-6-17(16)13-18/h3-9,11,13-14H,10,12,15H2,1-2H3 |
| InChIKey | XYARHXXODRLZGP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |