C24H25ClN2O3 — CID 24682481
4-chloro-N-[4-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-4-oxobutyl]benzamide (PubChem CID 24682481) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is 4-chloro-N-[4-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 24682481 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 4-chloro-N-[4-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-4-oxobutyl]benzamide |
| SMILES | COc1ccc2cc(CN(C)C(=O)CCCNC(=O)c3ccc(Cl)cc3)ccc2c1 |
| InChI | InChI=1S/C24H25ClN2O3/c1-27(16-17-5-6-20-15-22(30-2)12-9-19(20)14-17)23(28)4-3-13-26-24(29)18-7-10-21(25)11-8-18/h5-12,14-15H,3-4,13,16H2,1-2H3,(H,26,29) |
| InChIKey | GEFLITVFNWGTJE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|