C22H25ClN2O3 — CID 18198372
4-chloro-N-[4-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-4-oxobutyl]benzamide (PubChem CID 18198372) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is 4-chloro-N-[4-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 18198372 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-chloro-N-[4-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-4-oxobutyl]benzamide |
| SMILES | COc1ccc(CN(C(=O)CCCNC(=O)c2ccc(Cl)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-28-20-12-4-16(5-13-20)15-25(19-10-11-19)21(26)3-2-14-24-22(27)17-6-8-18(23)9-7-17/h4-9,12-13,19H,2-3,10-11,14-15H2,1H3,(H,24,27) |
| InChIKey | ALOAUXNWIUUDHW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|