About methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate
methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate (PubChem CID 115190775) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate.
Analyze methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate?
The IUPAC name of methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate (CID 115190775) is methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate.
What is the SMILES notation for methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate?
The canonical SMILES for methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate is COC(=O)N(C)CCc1ccc(OC)cc1OC.
What is the InChIKey of methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate?
The InChIKey is FKEMCVSBLWHQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4/c1-14(13(15)18-4)8-7-10-5-6-11(16-2)9-12(10)17-3/h5-6,9H,7-8H2,1-4H3.
What are the key properties of methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate?
methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate has a molecular weight of 253.30 g/mol, XLogP of 1.94, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(2,4-dimethoxyphenyl)ethyl]-N-methylcarbamate is sourced from PubChem (CID 115190775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).