C13H19NO2S — CID 115170407
2-(4-methoxy-2,5-dimethylphenyl)ethyl-methylcarbamothioic S-acid (PubChem CID 115170407) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-(4-methoxy-2,5-dimethylphenyl)ethyl-methylcarbamothioic S-acid.
| Compound Name | 2-(4-methoxy-2,5-dimethylphenyl)ethyl-methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 115170407 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(4-methoxy-2,5-dimethylphenyl)ethyl-methylcarbamothioic S-acid |
| SMILES | COc1cc(C)c(CCN(C)C(=O)S)cc1C |
| InChI | InChI=1S/C13H19NO2S/c1-9-8-12(16-4)10(2)7-11(9)5-6-14(3)13(15)17/h7-8H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | CFZALHBNZORXBY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|