C13H18BrNO3 — CID 115194111
N-[2-(4,5-dimethoxy-2-methylphenyl)ethyl]-N-methylcarbamoyl bromide (PubChem CID 115194111) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is N-[2-(4,5-dimethoxy-2-methylphenyl)ethyl]-N-methylcarbamoyl bromide.
| Compound Name | N-[2-(4,5-dimethoxy-2-methylphenyl)ethyl]-N-methylcarbamoyl bromide |
|---|---|
| PubChem CID | 115194111 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[2-(4,5-dimethoxy-2-methylphenyl)ethyl]-N-methylcarbamoyl bromide |
| SMILES | COc1cc(C)c(CCN(C)C(=O)Br)cc1OC |
| InChI | InChI=1S/C13H18BrNO3/c1-9-7-11(17-3)12(18-4)8-10(9)5-6-15(2)13(14)16/h7-8H,5-6H2,1-4H3 |
| InChIKey | PTOLIYYIWHOZSJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|