C11H14BrNO3 — CID 115193611
N-[(4,5-dimethoxy-2-methylphenyl)methyl]carbamoyl bromide (PubChem CID 115193611) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-methylphenyl)methyl]carbamoyl bromide.
| Compound Name | N-[(4,5-dimethoxy-2-methylphenyl)methyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115193611 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | N-[(4,5-dimethoxy-2-methylphenyl)methyl]carbamoyl bromide |
| SMILES | COc1cc(C)c(CNC(=O)Br)cc1OC |
| InChI | InChI=1S/C11H14BrNO3/c1-7-4-9(15-2)10(16-3)5-8(7)6-13-11(12)14/h4-5H,6H2,1-3H3,(H,13,14) |
| InChIKey | LROAYNGFUJNSAY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|