C14H19NO3 — CID 115176376
N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3-oxobutanamide (PubChem CID 115176376) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3-oxobutanamide.
| Compound Name | N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 115176376 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3-oxobutanamide |
| SMILES | COc1cc(C)c(CNC(=O)CC(C)=O)cc1C |
| InChI | InChI=1S/C14H19NO3/c1-9-6-13(18-4)10(2)5-12(9)8-15-14(17)7-11(3)16/h5-6H,7-8H2,1-4H3,(H,15,17) |
| InChIKey | UWWYRPDIROVVDL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|