C15H23NO2 — CID 110788062
N-[2-(4-methoxy-2,5-dimethylphenyl)ethyl]butanamide (PubChem CID 110788062) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-[2-(4-methoxy-2,5-dimethylphenyl)ethyl]butanamide.
| Compound Name | N-[2-(4-methoxy-2,5-dimethylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 110788062 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-[2-(4-methoxy-2,5-dimethylphenyl)ethyl]butanamide |
| SMILES | CCCC(=O)NCCc1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C15H23NO2/c1-5-6-15(17)16-8-7-13-9-12(3)14(18-4)10-11(13)2/h9-10H,5-8H2,1-4H3,(H,16,17) |
| InChIKey | KXQBUZWDSSAHNP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |