C13H19NO2S — CID 115167371
N-[2-(4-methoxy-2,5-dimethylphenyl)ethyl]-2-sulfanylacetamide (PubChem CID 115167371) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-[2-(4-methoxy-2,5-dimethylphenyl)ethyl]-2-sulfanylacetamide.
| Compound Name | N-[2-(4-methoxy-2,5-dimethylphenyl)ethyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115167371 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[2-(4-methoxy-2,5-dimethylphenyl)ethyl]-2-sulfanylacetamide |
| SMILES | COc1cc(C)c(CCNC(=O)CS)cc1C |
| InChI | InChI=1S/C13H19NO2S/c1-9-7-12(16-3)10(2)6-11(9)4-5-14-13(15)8-17/h6-7,17H,4-5,8H2,1-3H3,(H,14,15) |
| InChIKey | CVTFPSOQYYEXSE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|