C13H19NOS — CID 115167394
2-sulfanyl-N-[2-(2,4,5-trimethylphenyl)ethyl]acetamide (PubChem CID 115167394) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-sulfanyl-N-[2-(2,4,5-trimethylphenyl)ethyl]acetamide.
| Compound Name | 2-sulfanyl-N-[2-(2,4,5-trimethylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 115167394 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-sulfanyl-N-[2-(2,4,5-trimethylphenyl)ethyl]acetamide |
| SMILES | Cc1cc(C)c(CCNC(=O)CS)cc1C |
| InChI | InChI=1S/C13H19NOS/c1-9-6-11(3)12(7-10(9)2)4-5-14-13(15)8-16/h6-7,16H,4-5,8H2,1-3H3,(H,14,15) |
| InChIKey | PUAPAFYJGZSDMF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|