C14H21NO2 — CID 96661088
N-(3-hydroxypropyl)-2-(2,4,5-trimethylphenyl)acetamide (PubChem CID 96661088) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-(2,4,5-trimethylphenyl)acetamide.
| Compound Name | N-(3-hydroxypropyl)-2-(2,4,5-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 96661088 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(3-hydroxypropyl)-2-(2,4,5-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(CC(=O)NCCCO)cc1C |
| InChI | InChI=1S/C14H21NO2/c1-10-7-12(3)13(8-11(10)2)9-14(17)15-5-4-6-16/h7-8,16H,4-6,9H2,1-3H3,(H,15,17) |
| InChIKey | ZZWQTHFRGNHXBZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|