C12H18N2O2 — CID 102704987
5-amino-N-(3-hydroxypropyl)-2,4-dimethylbenzamide (PubChem CID 102704987) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxypropyl)-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-(3-hydroxypropyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 102704987 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 5-amino-N-(3-hydroxypropyl)-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NCCCO)cc1N |
| InChI | InChI=1S/C12H18N2O2/c1-8-6-9(2)11(13)7-10(8)12(16)14-4-3-5-15/h6-7,15H,3-5,13H2,1-2H3,(H,14,16) |
| InChIKey | OQCNNRRDRXYVFI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|