C13H16N2O — CID 102705618
5-amino-N-but-3-ynyl-2,4-dimethylbenzamide (PubChem CID 102705618) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-amino-N-but-3-ynyl-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-but-3-ynyl-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 102705618 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-amino-N-but-3-ynyl-2,4-dimethylbenzamide |
| SMILES | C#CCCNC(=O)c1cc(N)c(C)cc1C |
| InChI | InChI=1S/C13H16N2O/c1-4-5-6-15-13(16)11-8-12(14)10(3)7-9(11)2/h1,7-8H,5-6,14H2,2-3H3,(H,15,16) |
| InChIKey | NDBGLMRZOXMZRH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|