C13H20N2O2S — CID 102705947
5-amino-2,4-dimethyl-N-(3-methylsulfinylpropyl)benzamide (PubChem CID 102705947) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 5-amino-2,4-dimethyl-N-(3-methylsulfinylpropyl)benzamide.
| Compound Name | 5-amino-2,4-dimethyl-N-(3-methylsulfinylpropyl)benzamide |
|---|---|
| PubChem CID | 102705947 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-amino-2,4-dimethyl-N-(3-methylsulfinylpropyl)benzamide |
| SMILES | Cc1cc(C)c(C(=O)NCCCS(C)=O)cc1N |
| InChI | InChI=1S/C13H20N2O2S/c1-9-7-10(2)12(14)8-11(9)13(16)15-5-4-6-18(3)17/h7-8H,4-6,14H2,1-3H3,(H,15,16) |
| InChIKey | ZJWVXYJJWACTJK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|