C13H19N3O2 — CID 102705008
5-amino-N-[2-(dimethylamino)-2-oxoethyl]-2,4-dimethylbenzamide (PubChem CID 102705008) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 102705008 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NCC(=O)N(C)C)cc1N |
| InChI | InChI=1S/C13H19N3O2/c1-8-5-9(2)11(14)6-10(8)13(18)15-7-12(17)16(3)4/h5-6H,7,14H2,1-4H3,(H,15,18) |
| InChIKey | GWHYRLWUSZJBKQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|