C15H25N3O — CID 102705513
5-amino-2,4-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]benzamide (PubChem CID 102705513) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 5-amino-2,4-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]benzamide.
| Compound Name | 5-amino-2,4-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 102705513 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 5-amino-2,4-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)NCCN(C)C(C)C)cc1N |
| InChI | InChI=1S/C15H25N3O/c1-10(2)18(5)7-6-17-15(19)13-9-14(16)12(4)8-11(13)3/h8-10H,6-7,16H2,1-5H3,(H,17,19) |
| InChIKey | XUECSGKUYWYRCU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|