C13H18Br2N2O — CID 103882713
2,4-dibromo-N-[2-[methyl(propan-2-yl)amino]ethyl]benzamide (PubChem CID 103882713) has the molecular formula C13H18Br2N2O and a molecular weight of 378.11 g/mol. Its IUPAC name is 2,4-dibromo-N-[2-[methyl(propan-2-yl)amino]ethyl]benzamide.
| Compound Name | 2,4-dibromo-N-[2-[methyl(propan-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 103882713 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 2,4-dibromo-N-[2-[methyl(propan-2-yl)amino]ethyl]benzamide |
| SMILES | CC(C)N(C)CCNC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H18Br2N2O/c1-9(2)17(3)7-6-16-13(18)11-5-4-10(14)8-12(11)15/h4-5,8-9H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | YRSPFDVOSHVURM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |