C10H11Br2NO2 — CID 103882043
2,4-dibromo-N-(2-methoxyethyl)benzamide (PubChem CID 103882043) has the molecular formula C10H11Br2NO2 and a molecular weight of 337.01 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-methoxyethyl)benzamide.
| Compound Name | 2,4-dibromo-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 103882043 |
| Molecular Formula | C10H11Br2NO2 |
| Molecular Weight | 337.01 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 2,4-dibromo-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H11Br2NO2/c1-15-5-4-13-10(14)8-3-2-7(11)6-9(8)12/h2-3,6H,4-5H2,1H3,(H,13,14) |
| InChIKey | LXIPGDJRCPTGOL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.01 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|